C19H15F3N2O — CID 172890631
N-(2-quinolin-2-ylethyl)-3-(trifluoromethyl)benzamide (PubChem CID 172890631) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is N-(2-quinolin-2-ylethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-quinolin-2-ylethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 172890631 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-(2-quinolin-2-ylethyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCc1ccc2ccccc2n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O/c20-19(21,22)15-6-3-5-14(12-15)18(25)23-11-10-16-9-8-13-4-1-2-7-17(13)24-16/h1-9,12H,10-11H2,(H,23,25) |
| InChIKey | HNDYXRCEZOOBFA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |