C16H14F3NO3 — CID 78796629
N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 78796629) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 78796629 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO3/c17-16(18,19)12-3-1-2-11(9-12)15(23)20-7-6-10-4-5-13(21)14(22)8-10/h1-5,8-9,21-22H,6-7H2,(H,20,23) |
| InChIKey | OQXUMYZYFWBBJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|