C23H19F3N2O3 — CID 91058519
3-[4-(hydroxycarbamoyl)phenyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 91058519) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 91058519 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NO)c1ccc(-c2cccc(C(=O)NCCc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C23H19F3N2O3/c24-23(25,26)20-6-1-3-15(13-20)11-12-27-21(29)19-5-2-4-18(14-19)16-7-9-17(10-8-16)22(30)28-31/h1-10,13-14,31H,11-12H2,(H,27,29)(H,28,30) |
| InChIKey | CHSQFSYANJSXFI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|