C21H15F3N2O3 — CID 10126715
N-[3-[4-(hydroxycarbamoyl)phenyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 10126715) has the molecular formula C21H15F3N2O3 and a molecular weight of 400.36 g/mol. Its IUPAC name is N-[3-[4-(hydroxycarbamoyl)phenyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(hydroxycarbamoyl)phenyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10126715 |
| Molecular Formula | C21H15F3N2O3 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[3-[4-(hydroxycarbamoyl)phenyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NO)c1ccc(-c2cccc(NC(=O)c3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C21H15F3N2O3/c22-21(23,24)17-5-1-4-16(11-17)19(27)25-18-6-2-3-15(12-18)13-7-9-14(10-8-13)20(28)26-29/h1-12,29H,(H,25,27)(H,26,28) |
| InChIKey | CHBYTQQHMIFBOK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|