C20H15FN2O3 — CID 10308934
4-[3-[(4-fluorobenzoyl)amino]phenyl]-N-hydroxybenzamide (PubChem CID 10308934) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is 4-[3-[(4-fluorobenzoyl)amino]phenyl]-N-hydroxybenzamide.
| Compound Name | 4-[3-[(4-fluorobenzoyl)amino]phenyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 10308934 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[3-[(4-fluorobenzoyl)amino]phenyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(-c2cccc(NC(=O)c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C20H15FN2O3/c21-17-10-8-14(9-11-17)19(24)22-18-3-1-2-16(12-18)13-4-6-15(7-5-13)20(25)23-26/h1-12,26H,(H,22,24)(H,23,25) |
| InChIKey | CKRATVOTFKLMQW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|