C26H28FN3O — CID 44524357
4-fluoro-N-[3-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]phenyl]benzamide (PubChem CID 44524357) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-fluoro-N-[3-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 44524357 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 4-fluoro-N-[3-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]phenyl]benzamide |
| SMILES | CN1CCCN(Cc2ccc(-c3cccc(NC(=O)c4ccc(F)cc4)c3)cc2)CC1 |
| InChI | InChI=1S/C26H28FN3O/c1-29-14-3-15-30(17-16-29)19-20-6-8-21(9-7-20)23-4-2-5-25(18-23)28-26(31)22-10-12-24(27)13-11-22/h2,4-13,18H,3,14-17,19H2,1H3,(H,28,31) |
| InChIKey | FRRQJDTXBNHSFU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |