C27H21N3O4 — CID 10238468
4-(3,5-dibenzamidophenyl)-N-hydroxybenzamide (PubChem CID 10238468) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is 4-(3,5-dibenzamidophenyl)-N-hydroxybenzamide.
| Compound Name | 4-(3,5-dibenzamidophenyl)-N-hydroxybenzamide |
|---|---|
| PubChem CID | 10238468 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 4-(3,5-dibenzamidophenyl)-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(-c2cc(NC(=O)c3ccccc3)cc(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H21N3O4/c31-25(19-7-3-1-4-8-19)28-23-15-22(18-11-13-21(14-12-18)27(33)30-34)16-24(17-23)29-26(32)20-9-5-2-6-10-20/h1-17,34H,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | DUBZONMPGNNEBS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|