C23H20ClN3O4 — CID 87916115
3-[(4-chlorobenzoyl)amino]-5-[4-(hydroxycarbamoyl)phenyl]-N,N-dimethylbenzamide (PubChem CID 87916115) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is 3-[(4-chlorobenzoyl)amino]-5-[4-(hydroxycarbamoyl)phenyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-chlorobenzoyl)amino]-5-[4-(hydroxycarbamoyl)phenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 87916115 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-[(4-chlorobenzoyl)amino]-5-[4-(hydroxycarbamoyl)phenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(NC(=O)c2ccc(Cl)cc2)cc(-c2ccc(C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-27(2)23(30)18-11-17(14-3-5-16(6-4-14)22(29)26-31)12-20(13-18)25-21(28)15-7-9-19(24)10-8-15/h3-13,31H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | XUSOGHGNYAFODO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|