C27H29N3O5 — CID 87916077
N-[3-(diethylcarbamoyl)-5-[4-(hydroxycarbamoyl)phenyl]phenyl]-4-methoxy-2-methylbenzamide (PubChem CID 87916077) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)-5-[4-(hydroxycarbamoyl)phenyl]phenyl]-4-methoxy-2-methylbenzamide.
| Compound Name | N-[3-(diethylcarbamoyl)-5-[4-(hydroxycarbamoyl)phenyl]phenyl]-4-methoxy-2-methylbenzamide |
|---|---|
| PubChem CID | 87916077 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[3-(diethylcarbamoyl)-5-[4-(hydroxycarbamoyl)phenyl]phenyl]-4-methoxy-2-methylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(NC(=O)c2ccc(OC)cc2C)cc(-c2ccc(C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C27H29N3O5/c1-5-30(6-2)27(33)21-14-20(18-7-9-19(10-8-18)25(31)29-34)15-22(16-21)28-26(32)24-12-11-23(35-4)13-17(24)3/h7-16,34H,5-6H2,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | IRIIYGWZLRJLNR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|