C23H25N3O3 — CID 17488486
N-[4-(diethylcarbamoyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide (PubChem CID 17488486) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[4-(diethylcarbamoyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide.
| Compound Name | N-[4-(diethylcarbamoyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 17488486 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[4-(diethylcarbamoyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2cc3ccc(OC)cc3nc2C)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-5-26(6-2)23(28)16-7-10-18(11-8-16)25-22(27)20-13-17-9-12-19(29-4)14-21(17)24-15(20)3/h7-14H,5-6H2,1-4H3,(H,25,27) |
| InChIKey | ZRAQMUJUPHOUPZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |