C20H19N3O3 — CID 31859590
N-[4-(2-amino-2-oxoethyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide (PubChem CID 31859590) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 31859590 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-7-methoxy-2-methylquinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3ccc(CC(N)=O)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C20H19N3O3/c1-12-17(10-14-5-8-16(26-2)11-18(14)22-12)20(25)23-15-6-3-13(4-7-15)9-19(21)24/h3-8,10-11H,9H2,1-2H3,(H2,21,24)(H,23,25) |
| InChIKey | YIMQPUMTWDPHDU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |