C18H14F2N2O2 — CID 34319138
N-(3,5-difluorophenyl)-7-methoxy-2-methylquinoline-3-carboxamide (PubChem CID 34319138) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-7-methoxy-2-methylquinoline-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-7-methoxy-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 34319138 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(3,5-difluorophenyl)-7-methoxy-2-methylquinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3cc(F)cc(F)c3)c(C)nc2c1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-10-16(5-11-3-4-15(24-2)9-17(11)21-10)18(23)22-14-7-12(19)6-13(20)8-14/h3-9H,1-2H3,(H,22,23) |
| InChIKey | YJHAFVOVXLOQTN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |