C31H29N3O5 — CID 87916092
3-[4-(hydroxycarbamoyl)phenyl]-N-[2-(4-methoxyphenyl)ethyl]-5-[(4-methylbenzoyl)amino]benzamide (PubChem CID 87916092) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-(4-methoxyphenyl)ethyl]-5-[(4-methylbenzoyl)amino]benzamide.
| Compound Name | 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-(4-methoxyphenyl)ethyl]-5-[(4-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 87916092 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 3-[4-(hydroxycarbamoyl)phenyl]-N-[2-(4-methoxyphenyl)ethyl]-5-[(4-methylbenzoyl)amino]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2cc(NC(=O)c3ccc(C)cc3)cc(-c3ccc(C(=O)NO)cc3)c2)cc1 |
| InChI | InChI=1S/C31H29N3O5/c1-20-3-7-23(8-4-20)30(36)33-27-18-25(22-9-11-24(12-10-22)31(37)34-38)17-26(19-27)29(35)32-16-15-21-5-13-28(39-2)14-6-21/h3-14,17-19,38H,15-16H2,1-2H3,(H,32,35)(H,33,36)(H,34,37) |
| InChIKey | KQGHLDFDJMSBPC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|