C17H17F3N2O3S — CID 134803729
CID 134803729 (PubChem CID 134803729) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol.
| Compound Name | CID 134803729 |
|---|---|
| PubChem CID | 134803729 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])NCCNC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-26(24,25)22-10-9-21-16(23)13-7-5-12(6-8-13)14-3-2-4-15(11-14)17(18,19)20/h2-8,11H,9-10H2,1H3,(H2-,21,22,23,24,25) |
| InChIKey | QIWVZZQMVHMOQW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|