C18H17F3N2O2 — CID 134803671
N-(2-acetamidoethyl)-4-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 134803671) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-(2-acetamidoethyl)-4-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 134803671 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H17F3N2O2/c1-12(24)22-9-10-23-17(25)14-7-5-13(6-8-14)15-3-2-4-16(11-15)18(19,20)21/h2-8,11H,9-10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | LLRGOLVFKDOLEZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|