C22H19FN4O2 — CID 86899115
1-(2-fluoro-6-phenoxyphenyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea (PubChem CID 86899115) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-(2-fluoro-6-phenoxyphenyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea.
| Compound Name | 1-(2-fluoro-6-phenoxyphenyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 86899115 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-(2-fluoro-6-phenoxyphenyl)-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)urea |
| SMILES | O=C(NCCc1cn2ccccc2n1)Nc1c(F)cccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H19FN4O2/c23-18-9-6-10-19(29-17-7-2-1-3-8-17)21(18)26-22(28)24-13-12-16-15-27-14-5-4-11-20(27)25-16/h1-11,14-15H,12-13H2,(H2,24,26,28) |
| InChIKey | STESGAHCFPGHJT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |