C24H19N5O3 — CID 166226633
N'-(3-cyano-4-phenoxyphenyl)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)oxamide (PubChem CID 166226633) has the molecular formula C24H19N5O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is N'-(3-cyano-4-phenoxyphenyl)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)oxamide.
| Compound Name | N'-(3-cyano-4-phenoxyphenyl)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)oxamide |
|---|---|
| PubChem CID | 166226633 |
| Molecular Formula | C24H19N5O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N'-(3-cyano-4-phenoxyphenyl)-N-(2-imidazo[1,2-a]pyridin-2-ylethyl)oxamide |
| SMILES | N#Cc1cc(NC(=O)C(=O)NCCc2cn3ccccc3n2)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H19N5O3/c25-15-17-14-18(9-10-21(17)32-20-6-2-1-3-7-20)28-24(31)23(30)26-12-11-19-16-29-13-5-4-8-22(29)27-19/h1-10,13-14,16H,11-12H2,(H,26,30)(H,28,31) |
| InChIKey | JVRKJHOKACDMDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|