C16H13ClN4 — CID 133285740
5-chloro-2-(2-imidazo[1,2-a]pyridin-2-ylethylamino)benzonitrile (PubChem CID 133285740) has the molecular formula C16H13ClN4 and a molecular weight of 296.76 g/mol. Its IUPAC name is 5-chloro-2-(2-imidazo[1,2-a]pyridin-2-ylethylamino)benzonitrile.
| Compound Name | 5-chloro-2-(2-imidazo[1,2-a]pyridin-2-ylethylamino)benzonitrile |
|---|---|
| PubChem CID | 133285740 |
| Molecular Formula | C16H13ClN4 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-chloro-2-(2-imidazo[1,2-a]pyridin-2-ylethylamino)benzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H13ClN4/c17-13-4-5-15(12(9-13)10-18)19-7-6-14-11-21-8-2-1-3-16(21)20-14/h1-5,8-9,11,19H,6-7H2 |
| InChIKey | XTZVWDMMFQXZKK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |