C16H15N5O3 — CID 31257184
4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-3-nitrobenzamide (PubChem CID 31257184) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-3-nitrobenzamide.
| Compound Name | 4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 31257184 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(2-imidazo[1,2-a]pyridin-2-ylethylamino)-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(NCCc2cn3ccccc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N5O3/c17-16(22)11-4-5-13(14(9-11)21(23)24)18-7-6-12-10-20-8-2-1-3-15(20)19-12/h1-5,8-10,18H,6-7H2,(H2,17,22) |
| InChIKey | CWCVPMKOXRVYFM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|