C9H11N3 — CID 7536516
2-imidazo[1,2-a]pyridin-2-ylethanamine (PubChem CID 7536516) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-2-ylethanamine.
| Compound Name | 2-imidazo[1,2-a]pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 7536516 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-2-ylethanamine |
| SMILES | NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C9H11N3/c10-5-4-8-7-12-6-2-1-3-9(12)11-8/h1-3,6-7H,4-5,10H2 |
| InChIKey | CSIVCTHRYRVJCI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |