C10H14N2O — CID 91126513
ethane;imidazo[1,2-a]pyridin-2-ylmethanol (PubChem CID 91126513) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;imidazo[1,2-a]pyridin-2-ylmethanol.
| Compound Name | ethane;imidazo[1,2-a]pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 91126513 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | ethane;imidazo[1,2-a]pyridin-2-ylmethanol |
| SMILES | CC.OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C8H8N2O.C2H6/c11-6-7-5-10-4-2-1-3-8(10)9-7;1-2/h1-5,11H,6H2;1-2H3 |
| InChIKey | ZGGXGTSHKIGJLG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |