C15H11N3O — CID 7433386
2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile (PubChem CID 7433386) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile.
| Compound Name | 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 7433386 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccccc1OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C15H11N3O/c16-9-12-5-1-2-6-14(12)19-11-13-10-18-8-4-3-7-15(18)17-13/h1-8,10H,11H2 |
| InChIKey | XGIDAPWLMPRIKU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |