C15H12N4O — CID 61267731
5-amino-2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile (PubChem CID 61267731) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 5-amino-2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile.
| Compound Name | 5-amino-2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 61267731 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 5-amino-2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzonitrile |
| SMILES | N#Cc1cc(N)ccc1OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C15H12N4O/c16-8-11-7-12(17)4-5-14(11)20-10-13-9-19-6-2-1-3-15(19)18-13/h1-7,9H,10,17H2 |
| InChIKey | PYBVPRDWLUKPKB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|