3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid

C16H14N2O3 — CID 60698887

IUPAC3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid
SMILESCc1ccc(C(=O)O)cc1OCc1cn2ccccc2n1
InChIInChI=1S/C16H14N2O3/c1-11-5-6-12(16(19)20)8-14(11)21-10-13-9-18-7-3-2-4-15(18)17-13/h2-9H,10H2,1H3,(H,19,20)
InChIKeyYBLMAJXWSKIYHZ-UHFFFAOYSA-N
MW282.30 g/mol
LogP2.92
Rot. Bonds4

About 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid

3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid (PubChem CID 60698887) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid.

Molecular Properties

Compound Name3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid
PubChem CID60698887
Molecular FormulaC16H14N2O3
Molecular Weight282.30 g/mol
Exact Mass282.10
IUPAC Name3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid
SMILESCc1ccc(C(=O)O)cc1OCc1cn2ccccc2n1
InChIInChI=1S/C16H14N2O3/c1-11-5-6-12(16(19)20)8-14(11)21-10-13-9-18-7-3-2-4-15(18)17-13/h2-9H,10H2,1H3,(H,19,20)
InChIKeyYBLMAJXWSKIYHZ-UHFFFAOYSA-N
XLogP2.92
TPSA63.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 52.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid?
The IUPAC name of 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid (CID 60698887) is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid.
What is the SMILES notation for 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid?
The canonical SMILES for 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1OCc1cn2ccccc2n1.
What is the InChIKey of 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid?
The InChIKey is YBLMAJXWSKIYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-11-5-6-12(16(19)20)8-14(11)21-10-13-9-18-7-3-2-4-15(18)17-13/h2-9H,10H2,1H3,(H,19,20).
What are the key properties of 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid?
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid has a molecular weight of 282.30 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-4-methylbenzoic acid is sourced from PubChem (CID 60698887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).