C22H20N4O4S — CID 25492533
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-(4-methyl-3-sulfamoylphenyl)benzamide (PubChem CID 25492533) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-(4-methyl-3-sulfamoylphenyl)benzamide.
| Compound Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-(4-methyl-3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 25492533 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-(4-methyl-3-sulfamoylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(OCc3cn4ccccc4n3)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C22H20N4O4S/c1-15-5-8-17(12-20(15)31(23,28)29)25-22(27)16-6-9-19(10-7-16)30-14-18-13-26-11-3-2-4-21(26)24-18/h2-13H,14H2,1H3,(H,25,27)(H2,23,28,29) |
| InChIKey | ZAPALDXRSYWBAC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |