C23H21N3O2 — CID 56530964
4-ethyl-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide (PubChem CID 56530964) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-ethyl-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 4-ethyl-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 56530964 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-ethyl-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cccc(OCc3cn4ccccc4n3)c2)cc1 |
| InChI | InChI=1S/C23H21N3O2/c1-2-17-9-11-18(12-10-17)23(27)25-19-6-5-7-21(14-19)28-16-20-15-26-13-4-3-8-22(26)24-20/h3-15H,2,16H2,1H3,(H,25,27) |
| InChIKey | KMTMFDWOZAMHMU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |