C21H15F2N3O2 — CID 56530610
3,4-difluoro-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide (PubChem CID 56530610) has the molecular formula C21H15F2N3O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3,4-difluoro-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 3,4-difluoro-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 56530610 |
| Molecular Formula | C21H15F2N3O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3,4-difluoro-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OCc2cn3ccccc3n2)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H15F2N3O2/c22-18-8-7-14(10-19(18)23)21(27)25-15-4-3-5-17(11-15)28-13-16-12-26-9-2-1-6-20(26)24-16/h1-12H,13H2,(H,25,27) |
| InChIKey | IVVCWIJKONHCTF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |