C23H18FN3O2 — CID 56582329
(E)-3-(2-fluorophenyl)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 56582329) has the molecular formula C23H18FN3O2 and a molecular weight of 387.41 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56582329 |
| Molecular Formula | C23H18FN3O2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C23H18FN3O2/c24-21-9-2-1-6-17(21)11-12-23(28)26-18-7-5-8-20(14-18)29-16-19-15-27-13-4-3-10-22(27)25-19/h1-15H,16H2,(H,26,28)/b12-11+ |
| InChIKey | AZQARAMNNZHXRU-VAWYXSNFSA-N |
| XLogP | 4.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|