C22H19N3O4S — CID 56530937
N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-4-methylsulfonylbenzamide (PubChem CID 56530937) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 56530937 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2cccc(OCc3cn4ccccc4n3)c2)cc1 |
| InChI | InChI=1S/C22H19N3O4S/c1-30(27,28)20-10-8-16(9-11-20)22(26)24-17-5-4-6-19(13-17)29-15-18-14-25-12-3-2-7-21(25)23-18/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | GLMCXVPDYKUMRH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |