C22H20N4O4S — CID 27711748
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[4-(methylsulfamoyl)phenyl]benzamide (PubChem CID 27711748) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[4-(methylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[4-(methylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 27711748 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[4-(methylsulfamoyl)phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)c2cccc(OCc3cn4ccccc4n3)c2)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-23-31(28,29)20-10-8-17(9-11-20)25-22(27)16-5-4-6-19(13-16)30-15-18-14-26-12-3-2-7-21(26)24-18/h2-14,23H,15H2,1H3,(H,25,27) |
| InChIKey | AIMJJEIOOWKVSY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |