C23H28N4O3 — CID 56537785
N-[4-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)anilino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 56537785) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[4-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)anilino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)anilino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 56537785 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[4-[3-(imidazo[1,2-a]pyridin-2-ylmethoxy)anilino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)Nc1cccc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-23(2,3)22(29)24-12-7-11-21(28)26-17-8-6-9-19(14-17)30-16-18-15-27-13-5-4-10-20(27)25-18/h4-6,8-10,13-15H,7,11-12,16H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | JYKDXJKQGVSPNS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|