C16H13N3O2 — CID 103567182
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-5-methoxybenzonitrile (PubChem CID 103567182) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-5-methoxybenzonitrile.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 103567182 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(OCc2cn3ccccc3n2)c1 |
| InChI | InChI=1S/C16H13N3O2/c1-20-14-6-12(9-17)7-15(8-14)21-11-13-10-19-5-3-2-4-16(19)18-13/h2-8,10H,11H2,1H3 |
| InChIKey | OUXRGKZGZDTHHK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |