C15H13N3O2 — CID 60655585
imidazo[1,2-a]pyridin-2-ylmethyl 4-aminobenzoate (PubChem CID 60655585) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 4-aminobenzoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 4-aminobenzoate |
|---|---|
| PubChem CID | 60655585 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C15H13N3O2/c16-12-6-4-11(5-7-12)15(19)20-10-13-9-18-8-2-1-3-14(18)17-13/h1-9H,10,16H2 |
| InChIKey | PLINBCBRZWQQDS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|