C23H15N3O4 — CID 55372410
imidazo[1,2-a]pyridin-2-ylmethyl 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55372410) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55372410 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | Nc1c(C(=O)OCc2cn3ccccc3n2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H15N3O4/c24-20-17(23(29)30-12-13-11-26-10-4-3-7-18(26)25-13)9-8-16-19(20)22(28)15-6-2-1-5-14(15)21(16)27/h1-11H,12,24H2 |
| InChIKey | JHTMUQFAQCRQSI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|