C27H19N3O5S — CID 16611211
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16611211) has the molecular formula C27H19N3O5S and a molecular weight of 497.53 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 16611211 |
| Molecular Formula | C27H19N3O5S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)c2ccc3c(c2N)C(=O)c2ccccc2C3=O)cs1 |
| InChI | InChI=1S/C27H19N3O5S/c1-15(31)30(17-7-3-2-4-8-17)27-29-16(14-36-27)13-35-26(34)21-12-11-20-22(23(21)28)25(33)19-10-6-5-9-18(19)24(20)32/h2-12,14H,13,28H2,1H3 |
| InChIKey | NBPYRRZDBURNJN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 119.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|