C21H20N2O3S — CID 7868354
[2-(N-acetyl-4-ethylanilino)-1,3-thiazol-4-yl]methyl benzoate (PubChem CID 7868354) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is [2-(N-acetyl-4-ethylanilino)-1,3-thiazol-4-yl]methyl benzoate.
| Compound Name | [2-(N-acetyl-4-ethylanilino)-1,3-thiazol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 7868354 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-(N-acetyl-4-ethylanilino)-1,3-thiazol-4-yl]methyl benzoate |
| SMILES | CCc1ccc(N(C(C)=O)c2nc(COC(=O)c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-3-16-9-11-19(12-10-16)23(15(2)24)21-22-18(14-27-21)13-26-20(25)17-7-5-4-6-8-17/h4-12,14H,3,13H2,1-2H3 |
| InChIKey | HHCSNTCAWJPDLV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |