C20H15N3O3S — CID 8018161
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 4-cyanobenzoate (PubChem CID 8018161) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 4-cyanobenzoate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018161 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl 4-cyanobenzoate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C20H15N3O3S/c1-14(24)23(18-5-3-2-4-6-18)20-22-17(13-27-20)12-26-19(25)16-9-7-15(11-21)8-10-16/h2-10,13H,12H2,1H3 |
| InChIKey | SLKBFLVCWIAZSA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |