C21H20N2O4S — CID 8790409
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (2R)-2-phenoxypropanoate (PubChem CID 8790409) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (2R)-2-phenoxypropanoate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (2R)-2-phenoxypropanoate |
|---|---|
| PubChem CID | 8790409 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (2R)-2-phenoxypropanoate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)[C@@H](C)Oc2ccccc2)cs1 |
| InChI | InChI=1S/C21H20N2O4S/c1-15(27-19-11-7-4-8-12-19)20(25)26-13-17-14-28-21(22-17)23(16(2)24)18-9-5-3-6-10-18/h3-12,14-15H,13H2,1-2H3/t15-/m1/s1 |
| InChIKey | XUMBWEMJDBLWID-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |