C20H17N3O3S — CID 167802219
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-pyridin-4-ylprop-2-enoate (PubChem CID 167802219) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-pyridin-4-ylprop-2-enoate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-pyridin-4-ylprop-2-enoate |
|---|---|
| PubChem CID | 167802219 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-pyridin-4-ylprop-2-enoate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)/C=C/c2ccncc2)cs1 |
| InChI | InChI=1S/C20H17N3O3S/c1-15(24)23(18-5-3-2-4-6-18)20-22-17(14-27-20)13-26-19(25)8-7-16-9-11-21-12-10-16/h2-12,14H,13H2,1H3/b8-7+ |
| InChIKey | YOJARCMWRBFNKC-BQYQJAHWSA-N |
| XLogP | 3.98 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|