C21H17ClN2O3S — CID 8603586
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 8603586) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8603586 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)/C=C/c2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C21H17ClN2O3S/c1-15(25)24(19-8-3-2-4-9-19)21-23-18(14-28-21)13-27-20(26)11-10-16-6-5-7-17(22)12-16/h2-12,14H,13H2,1H3/b11-10+ |
| InChIKey | RKXUGOSKROPOPX-ZHACJKMWSA-N |
| XLogP | 5.24 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|