C23H26N2O3S — CID 8519864
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl adamantane-2-carboxylate (PubChem CID 8519864) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl adamantane-2-carboxylate.
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519864 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl adamantane-2-carboxylate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)C2C3CC4CC(C3)CC2C4)cs1 |
| InChI | InChI=1S/C23H26N2O3S/c1-14(26)25(20-5-3-2-4-6-20)23-24-19(13-29-23)12-28-22(27)21-17-8-15-7-16(10-17)11-18(21)9-15/h2-6,13,15-18,21H,7-12H2,1H3 |
| InChIKey | UJOAPWNRYILSBN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |