C23H18N2O5S — CID 55313515
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 9,10-dioxoanthracene-1-carboxylate (PubChem CID 55313515) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 55313515 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)c2cccc3c2C(=O)c2ccccc2C3=O)cs1 |
| InChI | InChI=1S/C23H18N2O5S/c1-3-25(13(2)26)23-24-14(12-31-23)11-30-22(29)18-10-6-9-17-19(18)21(28)16-8-5-4-7-15(16)20(17)27/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | FWSZAVQEVGHOKL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|