C22H19ClN2O4S — CID 31201180
[2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-(4-chlorobenzoyl)benzoate (PubChem CID 31201180) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 31201180 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | [2-[acetyl(ethyl)amino]-1,3-thiazol-4-yl]methyl 2-(4-chlorobenzoyl)benzoate |
| SMILES | CCN(C(C)=O)c1nc(COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C22H19ClN2O4S/c1-3-25(14(2)26)22-24-17(13-30-22)12-29-21(28)19-7-5-4-6-18(19)20(27)15-8-10-16(23)11-9-15/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | BIQRYBJSOVWOKR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |