C22H21N3O2 — CID 7173026
imidazo[1,2-a]pyridin-2-ylmethyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 7173026) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7173026 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)OCc3cn4ccccc4n3)c2C)cc1 |
| InChI | InChI=1S/C22H21N3O2/c1-15-7-9-19(10-8-15)25-16(2)12-20(17(25)3)22(26)27-14-18-13-24-11-5-4-6-21(24)23-18/h4-13H,14H2,1-3H3 |
| InChIKey | WYLRTSVEGJGCKA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|