C15H12ClN3O2 — CID 60656920
imidazo[1,2-a]pyridin-2-ylmethyl 2-amino-4-chlorobenzoate (PubChem CID 60656920) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl 2-amino-4-chlorobenzoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 60656920 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-10-4-5-12(13(17)7-10)15(20)21-9-11-8-19-6-2-1-3-14(19)18-11/h1-8H,9,17H2 |
| InChIKey | XDJSDZKJFLPGDB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|