About 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline
5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline (PubChem CID 81175196) has the molecular formula C14H12ClN3O2S
and a molecular weight of 321.79 g/mol. Its IUPAC name is 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline.
Molecular Properties
| Compound Name | 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline |
| PubChem CID | 81175196 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline |
| SMILES | Nc1cc(Cl)ccc1S(=O)(=O)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C14H12ClN3O2S/c15-10-4-5-13(12(16)7-10)21(19,20)9-11-8-18-6-2-1-3-14(18)17-11/h1-8H,9,16H2 |
| InChIKey | ZAASPYMWNZPEPV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline?
The IUPAC name of 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline (CID 81175196) is 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline.
What is the SMILES notation for 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline?
The canonical SMILES for 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline is Nc1cc(Cl)ccc1S(=O)(=O)Cc1cn2ccccc2n1.
What is the InChIKey of 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline?
The InChIKey is ZAASPYMWNZPEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O2S/c15-10-4-5-13(12(16)7-10)21(19,20)9-11-8-18-6-2-1-3-14(18)17-11/h1-8H,9,16H2.
What are the key properties of 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline?
5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline has a molecular weight of 321.79 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(imidazo[1,2-a]pyridin-2-ylmethylsulfonyl)aniline is sourced from PubChem (CID 81175196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).