C16H15ClN2O2S — CID 71974621
2-[1-(4-chlorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine (PubChem CID 71974621) has the molecular formula C16H15ClN2O2S and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[1-(4-chlorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71974621 |
| Molecular Formula | C16H15ClN2O2S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine |
| SMILES | CC(c1ccc(Cl)cc1)S(=O)(=O)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H15ClN2O2S/c1-12(13-5-7-14(17)8-6-13)22(20,21)11-15-10-19-9-3-2-4-16(19)18-15/h2-10,12H,11H2,1H3 |
| InChIKey | NGRZBWFZWUONSB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |