C16H14F2N2O2S — CID 71974623
2-[1-(2,6-difluorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine (PubChem CID 71974623) has the molecular formula C16H14F2N2O2S and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-[1-(2,6-difluorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71974623 |
| Molecular Formula | C16H14F2N2O2S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)ethylsulfonylmethyl]imidazo[1,2-a]pyridine |
| SMILES | CC(c1c(F)cccc1F)S(=O)(=O)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H14F2N2O2S/c1-11(16-13(17)5-4-6-14(16)18)23(21,22)10-12-9-20-8-3-2-7-15(20)19-12/h2-9,11H,10H2,1H3 |
| InChIKey | MSVWNXZOPGDVHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |