C9H11N3O2S — CID 165442818
1-imidazo[1,2-a]pyridin-2-yl-N-methylmethanesulfonamide (PubChem CID 165442818) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-2-yl-N-methylmethanesulfonamide.
| Compound Name | 1-imidazo[1,2-a]pyridin-2-yl-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 165442818 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-2-yl-N-methylmethanesulfonamide |
| SMILES | CNS(=O)(=O)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-10-15(13,14)7-8-6-12-5-3-2-4-9(12)11-8/h2-6,10H,7H2,1H3 |
| InChIKey | DEIBKWKTPJPHQU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |