C14H11BrFN3 — CID 103741882
2-bromo-6-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline (PubChem CID 103741882) has the molecular formula C14H11BrFN3 and a molecular weight of 320.17 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline.
| Compound Name | 2-bromo-6-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 103741882 |
| Molecular Formula | C14H11BrFN3 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-bromo-6-fluoro-N-(imidazo[1,2-a]pyridin-2-ylmethyl)aniline |
| SMILES | Fc1cccc(Br)c1NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C14H11BrFN3/c15-11-4-3-5-12(16)14(11)17-8-10-9-19-7-2-1-6-13(19)18-10/h1-7,9,17H,8H2 |
| InChIKey | QMXBMWUOXYUMAU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |